Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Ethylene glycol, 99.8%, anhydrous, AcroSeal™
CAS: 107-21-1 Molecular Formula: C2H6O2 Molecular Weight (g/mol): 62.06 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol PubChem CID: 174 ChEBI: CHEBI:30742 IUPAC Name: ethane-1,2-diol SMILES: C(CO)O
| PubChem CID | 174 |
|---|---|
| CAS | 107-21-1 |
| Molecular Weight (g/mol) | 62.06 |
| ChEBI | CHEBI:30742 |
| SMILES | C(CO)O |
| Synonym | ethylene glycol,1,2-ethanediol,glycol,monoethylene glycol,1,2-dihydroxyethane,2-hydroxyethanol,glycol alcohol,ethylene alcohol,fridex,tescol |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2 |
Benzoyl Peroxide (wetted with ca. 25% Water) 75.0+%, TCI America™
CAS: 94-36-0 Molecular Formula: C14H10O4 Molecular Weight (g/mol): 242.23 MDL Number: MFCD00003071 InChI Key: OMPJBNCRMGITSC-UHFFFAOYSA-N Synonym: benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide PubChem CID: 7187 ChEBI: CHEBI:82405 IUPAC Name: benzoyl benzenecarboperoxoate SMILES: C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2
| PubChem CID | 7187 |
|---|---|
| CAS | 94-36-0 |
| Molecular Weight (g/mol) | 242.23 |
| ChEBI | CHEBI:82405 |
| MDL Number | MFCD00003071 |
| SMILES | C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 |
| Synonym | benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide |
| IUPAC Name | benzoyl benzenecarboperoxoate |
| InChI Key | OMPJBNCRMGITSC-UHFFFAOYSA-N |
| Molecular Formula | C14H10O4 |
Triphenylphosphine, 99+%
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
Furan, 99%, stab. with ca 250ppm BHT
CAS: 110-00-9 Molecular Formula: C4H4O Molecular Weight (g/mol): 68.08 MDL Number: MFCD00003222 InChI Key: YLQBMQCUIZJEEH-UHFFFAOYSA-N Synonym: divinylene oxide,furfuran,tetrole,oxole,oxacyclopentadiene,furane,1,4-epoxy-1,3-butadiene,axole,rcra waste number u124,furfurane PubChem CID: 8029 ChEBI: CHEBI:35559 IUPAC Name: furan SMILES: O1C=CC=C1
| PubChem CID | 8029 |
|---|---|
| CAS | 110-00-9 |
| Molecular Weight (g/mol) | 68.08 |
| ChEBI | CHEBI:35559 |
| MDL Number | MFCD00003222 |
| SMILES | O1C=CC=C1 |
| Synonym | divinylene oxide,furfuran,tetrole,oxole,oxacyclopentadiene,furane,1,4-epoxy-1,3-butadiene,axole,rcra waste number u124,furfurane |
| IUPAC Name | furan |
| InChI Key | YLQBMQCUIZJEEH-UHFFFAOYSA-N |
| Molecular Formula | C4H4O |
N-Acetylglycine, 99%
CAS: 543-24-8 Molecular Formula: C4H7NO3 Molecular Weight (g/mol): 117.1 MDL Number: MFCD00004275 InChI Key: OKJIRPAQVSHGFK-UHFFFAOYSA-N Synonym: n-acetylglycine,aceturic acid,acetamidoacetic acid,acetylglycine,ac-gly-oh,glycine, n-acetyl,acetylaminoacetic acid,acetylamino-acetic acid,acetylglycocoll,ethanoylaminoethanoic acid PubChem CID: 10972 ChEBI: CHEBI:40410 IUPAC Name: 2-acetamidoacetic acid SMILES: CC(=O)NCC(=O)O
| PubChem CID | 10972 |
|---|---|
| CAS | 543-24-8 |
| Molecular Weight (g/mol) | 117.1 |
| ChEBI | CHEBI:40410 |
| MDL Number | MFCD00004275 |
| SMILES | CC(=O)NCC(=O)O |
| Synonym | n-acetylglycine,aceturic acid,acetamidoacetic acid,acetylglycine,ac-gly-oh,glycine, n-acetyl,acetylaminoacetic acid,acetylamino-acetic acid,acetylglycocoll,ethanoylaminoethanoic acid |
| IUPAC Name | 2-acetamidoacetic acid |
| InChI Key | OKJIRPAQVSHGFK-UHFFFAOYSA-N |
| Molecular Formula | C4H7NO3 |
2,4,6-Tribromophenol, 98%
CAS: 118-79-6 Molecular Formula: C6H3Br3O Molecular Weight (g/mol): 330.80 MDL Number: MFCD00002150 InChI Key: BSWWXRFVMJHFBN-UHFFFAOYSA-N Synonym: tribromophenol,bromol,bromkal pur 3,xeroform,phenol, 2,4,6-tribromo,flammex 3bp,unii-ys6k3eu393,ccris 1658,great lakes ph-73,5175-83-7 bismuth 3+ salt PubChem CID: 1483 ChEBI: CHEBI:47696 IUPAC Name: 2,4,6-tribromophenol SMILES: OC1=C(Br)C=C(Br)C=C1Br
| PubChem CID | 1483 |
|---|---|
| CAS | 118-79-6 |
| Molecular Weight (g/mol) | 330.80 |
| ChEBI | CHEBI:47696 |
| MDL Number | MFCD00002150 |
| SMILES | OC1=C(Br)C=C(Br)C=C1Br |
| Synonym | tribromophenol,bromol,bromkal pur 3,xeroform,phenol, 2,4,6-tribromo,flammex 3bp,unii-ys6k3eu393,ccris 1658,great lakes ph-73,5175-83-7 bismuth 3+ salt |
| IUPAC Name | 2,4,6-tribromophenol |
| InChI Key | BSWWXRFVMJHFBN-UHFFFAOYSA-N |
| Molecular Formula | C6H3Br3O |
Tetramethylsilane, 99.9+%, NMR grade
CAS: 75-76-3 Molecular Formula: C4H12Si Molecular Weight (g/mol): 88.23 MDL Number: MFCD00008274 InChI Key: CZDYPVPMEAXLPK-UHFFFAOYSA-N Synonym: silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 PubChem CID: 6396 ChEBI: CHEBI:85361 IUPAC Name: tetramethylsilane SMILES: C[Si](C)(C)C
| PubChem CID | 6396 |
|---|---|
| CAS | 75-76-3 |
| Molecular Weight (g/mol) | 88.23 |
| ChEBI | CHEBI:85361 |
| MDL Number | MFCD00008274 |
| SMILES | C[Si](C)(C)C |
| Synonym | silane, tetramethyl,tetramethylsilicane,tetramethyl silane,silicon, tetramethyl,tetramethyl-silane,unii-41y0rbg14q,me4si,ch3 4si,si ch3 4,chembl68073 |
| IUPAC Name | tetramethylsilane |
| InChI Key | CZDYPVPMEAXLPK-UHFFFAOYSA-N |
| Molecular Formula | C4H12Si |
p-Toluenesulfonyl chloride, 99+%
CAS: 98-59-9 Molecular Formula: C7H7ClO2S Molecular Weight (g/mol): 190.64 MDL Number: MFCD00007450 InChI Key: YYROPELSRYBVMQ-UHFFFAOYSA-N Synonym: tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride PubChem CID: 7397 IUPAC Name: 4-methylbenzenesulfonyl chloride SMILES: CC1=CC=C(C=C1)S(Cl)(=O)=O
| PubChem CID | 7397 |
|---|---|
| CAS | 98-59-9 |
| Molecular Weight (g/mol) | 190.64 |
| MDL Number | MFCD00007450 |
| SMILES | CC1=CC=C(C=C1)S(Cl)(=O)=O |
| Synonym | tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride |
| IUPAC Name | 4-methylbenzenesulfonyl chloride |
| InChI Key | YYROPELSRYBVMQ-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClO2S |
4-Methyl-2-pentanol, 99+%
CAS: 108-11-2 Molecular Formula: C6H14O Molecular Weight (g/mol): 102.18 MDL Number: MFCD00004550 InChI Key: WVYWICLMDOOCFB-UHFFFAOYSA-N Synonym: 4-methyl-2-pentanol,2-pentanol, 4-methyl,isobutylmethylcarbinol,2-methyl-4-pentanol,methyl amyl alcohol,methyl isobutyl carbinol,mibc,1,3-dimethylbutanol,4-methylpentanol-2,isobutylmethylmethanol PubChem CID: 7910 IUPAC Name: 4-methylpentan-2-ol SMILES: CC(C)CC(C)O
| PubChem CID | 7910 |
|---|---|
| CAS | 108-11-2 |
| Molecular Weight (g/mol) | 102.18 |
| MDL Number | MFCD00004550 |
| SMILES | CC(C)CC(C)O |
| Synonym | 4-methyl-2-pentanol,2-pentanol, 4-methyl,isobutylmethylcarbinol,2-methyl-4-pentanol,methyl amyl alcohol,methyl isobutyl carbinol,mibc,1,3-dimethylbutanol,4-methylpentanol-2,isobutylmethylmethanol |
| IUPAC Name | 4-methylpentan-2-ol |
| InChI Key | WVYWICLMDOOCFB-UHFFFAOYSA-N |
| Molecular Formula | C6H14O |
1,10-Decanedithiol, 95%
CAS: 1191-67-9 Molecular Formula: C10H22S2 Molecular Weight (g/mol): 206.41 MDL Number: MFCD00022095 InChI Key: UOQACRNTVQWTFF-UHFFFAOYSA-N Synonym: 1,10-decanedithiol,1,10-dimercaptodecane,acmc-1bvry,1,10-didecyl mercaptan,decamethylene dimercaptan PubChem CID: 14494 IUPAC Name: decane-1,10-dithiol SMILES: SCCCCCCCCCCS
| PubChem CID | 14494 |
|---|---|
| CAS | 1191-67-9 |
| Molecular Weight (g/mol) | 206.41 |
| MDL Number | MFCD00022095 |
| SMILES | SCCCCCCCCCCS |
| Synonym | 1,10-decanedithiol,1,10-dimercaptodecane,acmc-1bvry,1,10-didecyl mercaptan,decamethylene dimercaptan |
| IUPAC Name | decane-1,10-dithiol |
| InChI Key | UOQACRNTVQWTFF-UHFFFAOYSA-N |
| Molecular Formula | C10H22S2 |
Dextran sulfate sodium salt, MW ca >500,000
CAS: 9011-18-1 Molecular Formula: (C6H7O5)m(C6H7O5)n Molecular Weight (g/mol): 40,000 MDL Number: MFCD00081551 InChI Key: BLFLLBZGZJTVJG-UHFFFAOYSA-N Synonym: benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin PubChem CID: 2337 ChEBI: CHEBI:116735 SMILES: *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*]
| PubChem CID | 2337 |
|---|---|
| CAS | 9011-18-1 |
| Molecular Weight (g/mol) | 40,000 |
| ChEBI | CHEBI:116735 |
| MDL Number | MFCD00081551 |
| SMILES | *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*] |
| Synonym | benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin |
| InChI Key | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Molecular Formula | (C6H7O5)m(C6H7O5)n |
Thiamine hydrochloride, 99% (dry wt.), may cont. up to 5% water
CAS: 67-03-8 Molecular Formula: C12H18Cl2N4OS Molecular Weight (g/mol): 337.263 MDL Number: MFCD00012780 InChI Key: DPJRMOMPQZCRJU-UHFFFAOYSA-M Synonym: thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride PubChem CID: 6202 ChEBI: CHEBI:49105 IUPAC Name: 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride SMILES: CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-]
| PubChem CID | 6202 |
|---|---|
| CAS | 67-03-8 |
| Molecular Weight (g/mol) | 337.263 |
| ChEBI | CHEBI:49105 |
| MDL Number | MFCD00012780 |
| SMILES | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] |
| Synonym | thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride |
| InChI Key | DPJRMOMPQZCRJU-UHFFFAOYSA-M |
| Molecular Formula | C12H18Cl2N4OS |
Diphenylamine, 99%, pure
CAS: 122-39-4 Molecular Formula: C12H11N Molecular Weight (g/mol): 169.23 InChI Key: DMBHHRLKUKUOEG-UHFFFAOYSA-N Synonym: diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald PubChem CID: 11487 ChEBI: CHEBI:4640 IUPAC Name: N-phenylaniline SMILES: C1=CC=C(C=C1)NC2=CC=CC=C2
| PubChem CID | 11487 |
|---|---|
| CAS | 122-39-4 |
| Molecular Weight (g/mol) | 169.23 |
| ChEBI | CHEBI:4640 |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |
| Synonym | diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald |
| IUPAC Name | N-phenylaniline |
| InChI Key | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| Molecular Formula | C12H11N |
Tetrakis(triphenylphosphine)palladium(0), 99%
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
2,2-Bis(hydroxymethyl)-2,2',2″-nitrilotriethanol, 98%
CAS: 6976-37-0 Molecular Formula: C8H19NO5 Molecular Weight (g/mol): 209.24 MDL Number: MFCD00002853 InChI Key: OWMVSZAMULFTJU-UHFFFAOYSA-N Synonym: bis-tris,bistris,2,2-bis hydroxymethyl-2,2',2-nitrilotriethanol,bis 2-hydroxyethyl aminotris hydroxymethyl methane,bis-tris buffer,1,3-propanediol, 2-bis 2-hydroxyethyl amino-2-hydroxymethyl,unii-q1xc3631cp,bis 2-hydroxyethyl amino-tris hydroxymethyl methane,2-bis 2-hydroxyethyl amino-2-hydroxymethyl propane-1,3-diol,bis 2-hydroxyethyl iminotris hydroxymethyl methane PubChem CID: 81462 ChEBI: CHEBI:41250 IUPAC Name: 2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol SMILES: C(CO)N(CCO)C(CO)(CO)CO
| PubChem CID | 81462 |
|---|---|
| CAS | 6976-37-0 |
| Molecular Weight (g/mol) | 209.24 |
| ChEBI | CHEBI:41250 |
| MDL Number | MFCD00002853 |
| SMILES | C(CO)N(CCO)C(CO)(CO)CO |
| Synonym | bis-tris,bistris,2,2-bis hydroxymethyl-2,2',2-nitrilotriethanol,bis 2-hydroxyethyl aminotris hydroxymethyl methane,bis-tris buffer,1,3-propanediol, 2-bis 2-hydroxyethyl amino-2-hydroxymethyl,unii-q1xc3631cp,bis 2-hydroxyethyl amino-tris hydroxymethyl methane,2-bis 2-hydroxyethyl amino-2-hydroxymethyl propane-1,3-diol,bis 2-hydroxyethyl iminotris hydroxymethyl methane |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | OWMVSZAMULFTJU-UHFFFAOYSA-N |
| Molecular Formula | C8H19NO5 |